C14H17N3S2 — CID 106805091
2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-ethylpentanenitrile (PubChem CID 106805091) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-ethylpentanenitrile.
| Compound Name | 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-ethylpentanenitrile |
|---|---|
| PubChem CID | 106805091 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-ethylpentanenitrile |
| SMILES | CCC(N)(C#N)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H17N3S2/c1-2-14(16,10-15)8-5-9-18-13-17-11-6-3-4-7-12(11)19-13/h3-4,6-7H,2,5,8-9,16H2,1H3 |
| InChIKey | YWGPVOMDXFOIET-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|