C13H18N2OS2 — CID 64812798
1-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpentan-2-ol (PubChem CID 64812798) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpentan-2-ol.
| Compound Name | 1-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 64812798 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpentan-2-ol |
| SMILES | CC(O)(CN)CCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H18N2OS2/c1-13(16,9-14)7-4-8-17-12-15-10-5-2-3-6-11(10)18-12/h2-3,5-6,16H,4,7-9,14H2,1H3 |
| InChIKey | BCKAPMOISJRTRT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|