C16H16N2O3S3 — CID 3444074
3-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-hydroxyphenyl)propane-1-sulfonamide (PubChem CID 3444074) has the molecular formula C16H16N2O3S3 and a molecular weight of 380.52 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-hydroxyphenyl)propane-1-sulfonamide.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-hydroxyphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 3444074 |
| Molecular Formula | C16H16N2O3S3 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-(2-hydroxyphenyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCSc1nc2ccccc2s1)Nc1ccccc1O |
| InChI | InChI=1S/C16H16N2O3S3/c19-14-8-3-1-6-12(14)18-24(20,21)11-5-10-22-16-17-13-7-2-4-9-15(13)23-16/h1-4,6-9,18-19H,5,10-11H2 |
| InChIKey | UPJAZVHUNTVDNH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|