C18H20N2O2S3 — CID 91005106
4-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)butane-1-sulfonamide (PubChem CID 91005106) has the molecular formula C18H20N2O2S3 and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)butane-1-sulfonamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 91005106 |
| Molecular Formula | C18H20N2O2S3 |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)butane-1-sulfonamide |
| SMILES | Cc1ccc(C(CCCSc2nc3ccccc3s2)S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20N2O2S3/c1-13-8-10-14(11-9-13)17(25(19,21)22)7-4-12-23-18-20-15-5-2-3-6-16(15)24-18/h2-3,5-6,8-11,17H,4,7,12H2,1H3,(H2,19,21,22) |
| InChIKey | DMOACJLVQHPGHD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|