C16H16N2O2S3 — CID 91142408
2-(1,3-benzothiazol-2-ylsulfanyl)-1-(3-methylphenyl)ethanesulfonamide (PubChem CID 91142408) has the molecular formula C16H16N2O2S3 and a molecular weight of 364.52 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(3-methylphenyl)ethanesulfonamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(3-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 91142408 |
| Molecular Formula | C16H16N2O2S3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1-(3-methylphenyl)ethanesulfonamide |
| SMILES | Cc1cccc(C(CSc2nc3ccccc3s2)S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H16N2O2S3/c1-11-5-4-6-12(9-11)15(23(17,19)20)10-21-16-18-13-7-2-3-8-14(13)22-16/h2-9,15H,10H2,1H3,(H2,17,19,20) |
| InChIKey | MMMAHHSIIRXZNB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |