C22H25N3O3S3 — CID 16550647
4-(1,3-benzothiazol-2-ylsulfanyl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 16550647) has the molecular formula C22H25N3O3S3 and a molecular weight of 475.66 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 16550647 |
| Molecular Formula | C22H25N3O3S3 |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CCCSc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O3S3/c1-17-8-10-18(11-9-17)31(27,28)25-14-12-24(13-15-25)21(26)7-4-16-29-22-23-19-5-2-3-6-20(19)30-22/h2-3,5-6,8-11H,4,7,12-16H2,1H3 |
| InChIKey | KTSIKQFFJBOMKP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|