C23H27N3O4S2 — CID 29363641
5-(1,3-benzothiazol-2-yl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 29363641) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 29363641 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)CCCCc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-30-18-10-12-19(13-11-18)32(28,29)26-16-14-25(15-17-26)23(27)9-5-4-8-22-24-20-6-2-3-7-21(20)31-22/h2-3,6-7,10-13H,4-5,8-9,14-17H2,1H3 |
| InChIKey | UWIYCXLKEVFPHR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|