C17H16F2N2O3S3 — CID 3869165
3-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(difluoromethoxy)phenyl]propane-1-sulfonamide (PubChem CID 3869165) has the molecular formula C17H16F2N2O3S3 and a molecular weight of 430.52 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(difluoromethoxy)phenyl]propane-1-sulfonamide.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(difluoromethoxy)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 3869165 |
| Molecular Formula | C17H16F2N2O3S3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-[4-(difluoromethoxy)phenyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCSc1nc2ccccc2s1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H16F2N2O3S3/c18-16(19)24-13-8-6-12(7-9-13)21-27(22,23)11-3-10-25-17-20-14-4-1-2-5-15(14)26-17/h1-2,4-9,16,21H,3,10-11H2 |
| InChIKey | JCXMNDAWXVHSRN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|