C19H22N2O4S3 — CID 18002984
4-[(6-methoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-(4-methoxyphenyl)butane-1-sulfonamide (PubChem CID 18002984) has the molecular formula C19H22N2O4S3 and a molecular weight of 438.60 g/mol. Its IUPAC name is 4-[(6-methoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-(4-methoxyphenyl)butane-1-sulfonamide.
| Compound Name | 4-[(6-methoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-(4-methoxyphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 18002984 |
| Molecular Formula | C19H22N2O4S3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-[(6-methoxy-1,3-benzothiazol-2-yl)sulfanyl]-N-(4-methoxyphenyl)butane-1-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)CCCCSc2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C19H22N2O4S3/c1-24-15-7-5-14(6-8-15)21-28(22,23)12-4-3-11-26-19-20-17-10-9-16(25-2)13-18(17)27-19/h5-10,13,21H,3-4,11-12H2,1-2H3 |
| InChIKey | RELHTAUGEKMWEA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|