C9H9N2O3S2- — CID 5049707
(6-methoxy-1,3-benzothiazol-2-yl)-methylsulfonylazanide (PubChem CID 5049707) has the molecular formula C9H9N2O3S2- and a molecular weight of 257.32 g/mol. Its IUPAC name is (6-methoxy-1,3-benzothiazol-2-yl)-methylsulfonylazanide.
| Compound Name | (6-methoxy-1,3-benzothiazol-2-yl)-methylsulfonylazanide |
|---|---|
| PubChem CID | 5049707 |
| Molecular Formula | C9H9N2O3S2- |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (6-methoxy-1,3-benzothiazol-2-yl)-methylsulfonylazanide |
| SMILES | COc1ccc2nc([N-]S(C)(=O)=O)sc2c1 |
| InChI | InChI=1S/C9H9N2O3S2/c1-14-6-3-4-7-8(5-6)15-9(10-7)11-16(2,12)13/h3-5H,1-2H3/q-1 |
| InChIKey | FRKACGYNCVRAOO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |