C13H12N2O5S3 — CID 87142557
2-(6-methoxy-1,3-benzothiazol-2-yl)-3,3-bis(methylsulfonyl)prop-2-enenitrile (PubChem CID 87142557) has the molecular formula C13H12N2O5S3 and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-(6-methoxy-1,3-benzothiazol-2-yl)-3,3-bis(methylsulfonyl)prop-2-enenitrile.
| Compound Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-3,3-bis(methylsulfonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 87142557 |
| Molecular Formula | C13H12N2O5S3 |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2-(6-methoxy-1,3-benzothiazol-2-yl)-3,3-bis(methylsulfonyl)prop-2-enenitrile |
| SMILES | COc1ccc2nc(C(C#N)=C(S(C)(=O)=O)S(C)(=O)=O)sc2c1 |
| InChI | InChI=1S/C13H12N2O5S3/c1-20-8-4-5-10-11(6-8)21-12(15-10)9(7-14)13(22(2,16)17)23(3,18)19/h4-6H,1-3H3 |
| InChIKey | HZKPHMYBVMSACA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|