C18H20FNO2S — CID 143479621
but-2-yne;(2Z,4E)-5-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)hexa-2,4-dien-3-ol (PubChem CID 143479621) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is but-2-yne;(2Z,4E)-5-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)hexa-2,4-dien-3-ol.
| Compound Name | but-2-yne;(2Z,4E)-5-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)hexa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 143479621 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | but-2-yne;(2Z,4E)-5-fluoro-2-(6-methoxy-1,3-benzothiazol-2-yl)hexa-2,4-dien-3-ol |
| SMILES | CC#CC.COc1ccc2nc(/C(C)=C(O)/C=C(\C)F)sc2c1 |
| InChI | InChI=1S/C14H14FNO2S.C4H6/c1-8(15)6-12(17)9(2)14-16-11-5-4-10(18-3)7-13(11)19-14;1-3-4-2/h4-7,17H,1-3H3;1-2H3/b8-6+,12-9-; |
| InChIKey | UYOOMBORMZRXGD-XGTSDSOOSA-N |
| XLogP | 5.50 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|