C9H10NO4PS — CID 175512314
(6-methoxy-1,3-benzothiazol-2-yl)oxy-methylphosphinic acid (PubChem CID 175512314) has the molecular formula C9H10NO4PS and a molecular weight of 259.22 g/mol. Its IUPAC name is (6-methoxy-1,3-benzothiazol-2-yl)oxy-methylphosphinic acid.
| Compound Name | (6-methoxy-1,3-benzothiazol-2-yl)oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 175512314 |
| Molecular Formula | C9H10NO4PS |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | (6-methoxy-1,3-benzothiazol-2-yl)oxy-methylphosphinic acid |
| SMILES | COc1ccc2nc(OP(C)(=O)O)sc2c1 |
| InChI | InChI=1S/C9H10NO4PS/c1-13-6-3-4-7-8(5-6)16-9(10-7)14-15(2,11)12/h3-5H,1-2H3,(H,11,12) |
| InChIKey | GLBOPHYBKYVBPX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|