C11H13NO3S — CID 67575086
2-methoxy-6-(2-methoxyethoxy)-1,3-benzothiazole (PubChem CID 67575086) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-methoxy-6-(2-methoxyethoxy)-1,3-benzothiazole.
| Compound Name | 2-methoxy-6-(2-methoxyethoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 67575086 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-methoxy-6-(2-methoxyethoxy)-1,3-benzothiazole |
| SMILES | COCCOc1ccc2nc(OC)sc2c1 |
| InChI | InChI=1S/C11H13NO3S/c1-13-5-6-15-8-3-4-9-10(7-8)16-11(12-9)14-2/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ADCBCKZGVAGYLK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|