C18H18N2O4S — CID 126644718
N-methoxy-2-[4-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]propanamide (PubChem CID 126644718) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-methoxy-2-[4-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]propanamide.
| Compound Name | N-methoxy-2-[4-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]propanamide |
|---|---|
| PubChem CID | 126644718 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-methoxy-2-[4-[(6-methoxy-1,3-benzothiazol-2-yl)oxy]phenyl]propanamide |
| SMILES | CONC(=O)C(C)c1ccc(Oc2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-11(17(21)20-23-3)12-4-6-13(7-5-12)24-18-19-15-9-8-14(22-2)10-16(15)25-18/h4-11H,1-3H3,(H,20,21) |
| InChIKey | QBGFNLWWNMMDRO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|