C17H15ClN2O4S — CID 160971171
(2R)-2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-N-methoxypropanamide (PubChem CID 160971171) has the molecular formula C17H15ClN2O4S and a molecular weight of 378.84 g/mol. Its IUPAC name is (2R)-2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-N-methoxypropanamide.
| Compound Name | (2R)-2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-N-methoxypropanamide |
|---|---|
| PubChem CID | 160971171 |
| Molecular Formula | C17H15ClN2O4S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | (2R)-2-[4-[(6-chloro-1,3-benzothiazol-2-yl)oxy]phenoxy]-N-methoxypropanamide |
| SMILES | CONC(=O)[C@@H](C)Oc1ccc(Oc2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C17H15ClN2O4S/c1-10(16(21)20-22-2)23-12-4-6-13(7-5-12)24-17-19-14-8-3-11(18)9-15(14)25-17/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | SYGRMSBYECQFIK-SNVBAGLBSA-N |
| XLogP | 4.19 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|