C13H15NO2S2 — CID 57414563
methyl 2-butylsulfanyl-1,3-benzothiazole-6-carboxylate (PubChem CID 57414563) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is methyl 2-butylsulfanyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-butylsulfanyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 57414563 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 2-butylsulfanyl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCSc1nc2ccc(C(=O)OC)cc2s1 |
| InChI | InChI=1S/C13H15NO2S2/c1-3-4-7-17-13-14-10-6-5-9(12(15)16-2)8-11(10)18-13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | BGDDEMMLPKBGOK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|