C13H17N3OS2 — CID 5204003
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-butylacetamide (PubChem CID 5204003) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-butylacetamide.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-butylacetamide |
|---|---|
| PubChem CID | 5204003 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H17N3OS2/c1-2-3-6-15-12(17)8-18-13-16-10-5-4-9(14)7-11(10)19-13/h4-5,7H,2-3,6,8,14H2,1H3,(H,15,17) |
| InChIKey | BPVCMEMNGNJAEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|