C10H10N2O2S2 — CID 760825
methyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 760825) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is methyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | methyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 760825 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | methyl 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-14-9(13)5-15-10-12-7-3-2-6(11)4-8(7)16-10/h2-4H,5,11H2,1H3 |
| InChIKey | DFFRZTIBLUVCSM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|