C12H15N3OS2 — CID 114281764
5-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]pentanamide (PubChem CID 114281764) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 5-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]pentanamide.
| Compound Name | 5-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]pentanamide |
|---|---|
| PubChem CID | 114281764 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]pentanamide |
| SMILES | NC(=O)CCCCSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H15N3OS2/c13-8-4-5-9-10(7-8)18-12(15-9)17-6-2-1-3-11(14)16/h4-5,7H,1-3,6,13H2,(H2,14,16) |
| InChIKey | JGJRQJAHNKWBEF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|