C14H19N3O2S2 — CID 177333382
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;methoxycyclobutane (PubChem CID 177333382) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;methoxycyclobutane.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;methoxycyclobutane |
|---|---|
| PubChem CID | 177333382 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;methoxycyclobutane |
| SMILES | COC1CCC1.NC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C9H9N3OS2.C5H10O/c10-5-1-2-6-7(3-5)15-9(12-6)14-4-8(11)13;1-6-5-3-2-4-5/h1-3H,4,10H2,(H2,11,13);5H,2-4H2,1H3 |
| InChIKey | RLOWYVBDCHSMSV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|