C15H21N3O3S2 — CID 177333371
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;3-methoxyoxane (PubChem CID 177333371) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;3-methoxyoxane.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;3-methoxyoxane |
|---|---|
| PubChem CID | 177333371 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]acetamide;3-methoxyoxane |
| SMILES | COC1CCCOC1.NC(=O)CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C9H9N3OS2.C6H12O2/c10-5-1-2-6-7(3-5)15-9(12-6)14-4-8(11)13;1-7-6-3-2-4-8-5-6/h1-3H,4,10H2,(H2,11,13);6H,2-5H2,1H3 |
| InChIKey | CKEIZNSDOIAVIE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|