C10H10N2O2S2 — CID 57063491
3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid (PubChem CID 57063491) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 57063491 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]propanoic acid |
| SMILES | Nc1ccc2nc(SCCC(=O)O)sc2c1 |
| InChI | InChI=1S/C10H10N2O2S2/c11-6-1-2-7-8(5-6)16-10(12-7)15-4-3-9(13)14/h1-2,5H,3-4,11H2,(H,13,14) |
| InChIKey | ZBIOBRIKQHHLSW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|