C11H14N2S2 — CID 3101507
2-butylsulfanyl-1,3-benzothiazol-6-amine (PubChem CID 3101507) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-butylsulfanyl-1,3-benzothiazol-6-amine.
| Compound Name | 2-butylsulfanyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 3101507 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-butylsulfanyl-1,3-benzothiazol-6-amine |
| SMILES | CCCCSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C11H14N2S2/c1-2-3-6-14-11-13-9-5-4-8(12)7-10(9)15-11/h4-5,7H,2-3,6,12H2,1H3 |
| InChIKey | IKDDAAYXSLTBCS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|