C10H12N2S2 — CID 130664278
2-propylsulfanyl-1,3-benzothiazol-5-amine (PubChem CID 130664278) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-propylsulfanyl-1,3-benzothiazol-5-amine.
| Compound Name | 2-propylsulfanyl-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 130664278 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 2-propylsulfanyl-1,3-benzothiazol-5-amine |
| SMILES | CCCSc1nc2cc(N)ccc2s1 |
| InChI | InChI=1S/C10H12N2S2/c1-2-5-13-10-12-8-6-7(11)3-4-9(8)14-10/h3-4,6H,2,5,11H2,1H3 |
| InChIKey | CJZAQKFCDNUORU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|