C18H19N3O2S2 — CID 141483854
2-[(5-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 141483854) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[(5-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 141483854 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-[(5-amino-1,3-benzothiazol-2-yl)sulfanyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc([C@H](C)NC(=O)CSc2nc3cc(N)ccc3s2)cc1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-11(12-3-6-14(23-2)7-4-12)20-17(22)10-24-18-21-15-9-13(19)5-8-16(15)25-18/h3-9,11H,10,19H2,1-2H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | KULTVPCVNBYQLV-NSHDSACASA-N |
| XLogP | 3.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|