C15H14N2O2S2 — CID 30842999
1-(2-butylsulfanyl-1,3-benzothiazol-6-yl)pyrrole-2,5-dione (PubChem CID 30842999) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(2-butylsulfanyl-1,3-benzothiazol-6-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2-butylsulfanyl-1,3-benzothiazol-6-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 30842999 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(2-butylsulfanyl-1,3-benzothiazol-6-yl)pyrrole-2,5-dione |
| SMILES | CCCCSc1nc2ccc(N3C(=O)C=CC3=O)cc2s1 |
| InChI | InChI=1S/C15H14N2O2S2/c1-2-3-8-20-15-16-11-5-4-10(9-12(11)21-15)17-13(18)6-7-14(17)19/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | NIUCOUAUSMVUMZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|