C24H18N2O4S2 — CID 2264126
2-[2-[2-(2-methoxyphenoxy)ethylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione (PubChem CID 2264126) has the molecular formula C24H18N2O4S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyphenoxy)ethylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-(2-methoxyphenoxy)ethylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2264126 |
| Molecular Formula | C24H18N2O4S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 2-[2-[2-(2-methoxyphenoxy)ethylsulfanyl]-1,3-benzothiazol-6-yl]isoindole-1,3-dione |
| SMILES | COc1ccccc1OCCSc1nc2ccc(N3C(=O)c4ccccc4C3=O)cc2s1 |
| InChI | InChI=1S/C24H18N2O4S2/c1-29-19-8-4-5-9-20(19)30-12-13-31-24-25-18-11-10-15(14-21(18)32-24)26-22(27)16-6-2-3-7-17(16)23(26)28/h2-11,14H,12-13H2,1H3 |
| InChIKey | BWPWKWBJBJRNEK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|