4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid

C15H12N2O2S2 — CID 2880608

IUPAC4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid
SMILESNc1ccc2nc(SCc3ccc(C(=O)O)cc3)sc2c1
InChIInChI=1S/C15H12N2O2S2/c16-11-5-6-12-13(7-11)21-15(17-12)20-8-9-1-3-10(4-2-9)14(18)19/h1-7H,8,16H2,(H,18,19)
InChIKeyPKIBTTICVOLYBM-UHFFFAOYSA-N
MW316.41 g/mol
LogP3.87
Rot. Bonds4

About 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid

4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid (PubChem CID 2880608) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid.

Molecular Properties

Compound Name4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid
PubChem CID2880608
Molecular FormulaC15H12N2O2S2
Molecular Weight316.41 g/mol
Exact Mass316.03
IUPAC Name4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid
SMILESNc1ccc2nc(SCc3ccc(C(=O)O)cc3)sc2c1
InChIInChI=1S/C15H12N2O2S2/c16-11-5-6-12-13(7-11)21-15(17-12)20-8-9-1-3-10(4-2-9)14(18)19/h1-7H,8,16H2,(H,18,19)
InChIKeyPKIBTTICVOLYBM-UHFFFAOYSA-N
XLogP3.87
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.41
LogP ≤ 53.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid?
The IUPAC name of 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid (CID 2880608) is 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid.
What is the SMILES notation for 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid?
The canonical SMILES for 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid is Nc1ccc2nc(SCc3ccc(C(=O)O)cc3)sc2c1.
What is the InChIKey of 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid?
The InChIKey is PKIBTTICVOLYBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S2/c16-11-5-6-12-13(7-11)21-15(17-12)20-8-9-1-3-10(4-2-9)14(18)19/h1-7H,8,16H2,(H,18,19).
What are the key properties of 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid?
4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid has a molecular weight of 316.41 g/mol, XLogP of 3.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzoic acid is sourced from PubChem (CID 2880608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).