C15H11N3S2 — CID 61359229
2-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzonitrile (PubChem CID 61359229) has the molecular formula C15H11N3S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzonitrile.
| Compound Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 61359229 |
| Molecular Formula | C15H11N3S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[(6-amino-1,3-benzothiazol-2-yl)sulfanylmethyl]benzonitrile |
| SMILES | N#Cc1ccccc1CSc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C15H11N3S2/c16-8-10-3-1-2-4-11(10)9-19-15-18-13-6-5-12(17)7-14(13)20-15/h1-7H,9,17H2 |
| InChIKey | PYYVSURKGFEEMI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|