C14H7BrFN3S2 — CID 107539612
4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-bromo-3-fluorobenzonitrile (PubChem CID 107539612) has the molecular formula C14H7BrFN3S2 and a molecular weight of 380.27 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-bromo-3-fluorobenzonitrile.
| Compound Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-bromo-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107539612 |
| Molecular Formula | C14H7BrFN3S2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 378.92 |
| IUPAC Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfanyl]-2-bromo-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Sc2nc3ccc(N)cc3s2)c(F)c1Br |
| InChI | InChI=1S/C14H7BrFN3S2/c15-12-7(6-17)1-4-10(13(12)16)20-14-19-9-3-2-8(18)5-11(9)21-14/h1-5H,18H2 |
| InChIKey | PXAZCJWTYZSEDT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|