C14H7ClN2S2 — CID 63538431
2-(1,3-benzothiazol-2-ylsulfanyl)-5-chlorobenzonitrile (PubChem CID 63538431) has the molecular formula C14H7ClN2S2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-5-chlorobenzonitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 63538431 |
| Molecular Formula | C14H7ClN2S2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)ccc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H7ClN2S2/c15-10-5-6-12(9(7-10)8-16)18-14-17-11-3-1-2-4-13(11)19-14/h1-7H |
| InChIKey | JJHZJTGYENBENM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |