C16H11N3OS2 — CID 168524356
N-[2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-2-cyanoacetamide (PubChem CID 168524356) has the molecular formula C16H11N3OS2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-2-cyanoacetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 168524356 |
| Molecular Formula | C16H11N3OS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)Nc1ccccc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H11N3OS2/c17-10-9-15(20)18-11-5-1-3-7-13(11)21-16-19-12-6-2-4-8-14(12)22-16/h1-8H,9H2,(H,18,20) |
| InChIKey | QYRGHVXWSODEBO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |