C17H13N3OS3 — CID 23853901
[4-[3-(1,3-benzothiazol-2-ylsulfanyl)propanoylamino]phenyl] thiocyanate (PubChem CID 23853901) has the molecular formula C17H13N3OS3 and a molecular weight of 371.51 g/mol. Its IUPAC name is [4-[3-(1,3-benzothiazol-2-ylsulfanyl)propanoylamino]phenyl] thiocyanate.
| Compound Name | [4-[3-(1,3-benzothiazol-2-ylsulfanyl)propanoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 23853901 |
| Molecular Formula | C17H13N3OS3 |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | [4-[3-(1,3-benzothiazol-2-ylsulfanyl)propanoylamino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)CCSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H13N3OS3/c18-11-23-13-7-5-12(6-8-13)19-16(21)9-10-22-17-20-14-3-1-2-4-15(14)24-17/h1-8H,9-10H2,(H,19,21) |
| InChIKey | LBNJNYOWUTWDTA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|