C14H11N3S3 — CID 169360129
[2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]thiourea (PubChem CID 169360129) has the molecular formula C14H11N3S3 and a molecular weight of 317.46 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]thiourea.
| Compound Name | [2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]thiourea |
|---|---|
| PubChem CID | 169360129 |
| Molecular Formula | C14H11N3S3 |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [2-(1,3-benzothiazol-2-ylsulfanyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccccc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11N3S3/c15-13(18)16-9-5-1-3-7-11(9)19-14-17-10-6-2-4-8-12(10)20-14/h1-8H,(H3,15,16,18) |
| InChIKey | XBFFSAXSDXRICJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|