C8H8N4S2 — CID 14712207
(1,3-benzothiazol-2-ylamino)thiourea (PubChem CID 14712207) has the molecular formula C8H8N4S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (1,3-benzothiazol-2-ylamino)thiourea.
| Compound Name | (1,3-benzothiazol-2-ylamino)thiourea |
|---|---|
| PubChem CID | 14712207 |
| Molecular Formula | C8H8N4S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | (1,3-benzothiazol-2-ylamino)thiourea |
| SMILES | NC(=S)NNc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H8N4S2/c9-7(13)11-12-8-10-5-3-1-2-4-6(5)14-8/h1-4H,(H,10,12)(H3,9,11,13) |
| InChIKey | KOKUHNVHXHRZPN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|