C14H9F2N3OS — CID 167897163
N'-(1,3-benzothiazol-2-yl)-3,4-difluorobenzohydrazide (PubChem CID 167897163) has the molecular formula C14H9F2N3OS and a molecular weight of 305.31 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-yl)-3,4-difluorobenzohydrazide.
| Compound Name | N'-(1,3-benzothiazol-2-yl)-3,4-difluorobenzohydrazide |
|---|---|
| PubChem CID | 167897163 |
| Molecular Formula | C14H9F2N3OS |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N'-(1,3-benzothiazol-2-yl)-3,4-difluorobenzohydrazide |
| SMILES | O=C(NNc1nc2ccccc2s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H9F2N3OS/c15-9-6-5-8(7-10(9)16)13(20)18-19-14-17-11-3-1-2-4-12(11)21-14/h1-7H,(H,17,19)(H,18,20) |
| InChIKey | FBZNVEIPXHMYFC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|