C15H13N5O2S — CID 155671124
1-[(3-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)urea (PubChem CID 155671124) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 1-[(3-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[(3-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 155671124 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-[(3-aminobenzoyl)amino]-3-(1,3-benzothiazol-2-yl)urea |
| SMILES | Nc1cccc(C(=O)NNC(=O)Nc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H13N5O2S/c16-10-5-3-4-9(8-10)13(21)19-20-14(22)18-15-17-11-6-1-2-7-12(11)23-15/h1-8H,16H2,(H,19,21)(H2,17,18,20,22) |
| InChIKey | TXCPNNVVCWXEDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|