C14H9Br2N5O2S — CID 175063879
1-(1,3-benzothiazol-2-yl)-3-[(3,5-dibromopyridine-4-carbonyl)amino]urea (PubChem CID 175063879) has the molecular formula C14H9Br2N5O2S and a molecular weight of 471.13 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[(3,5-dibromopyridine-4-carbonyl)amino]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[(3,5-dibromopyridine-4-carbonyl)amino]urea |
|---|---|
| PubChem CID | 175063879 |
| Molecular Formula | C14H9Br2N5O2S |
| Molecular Weight | 471.13 g/mol |
| Exact Mass | 468.88 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[(3,5-dibromopyridine-4-carbonyl)amino]urea |
| SMILES | O=C(NNC(=O)c1c(Br)cncc1Br)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H9Br2N5O2S/c15-7-5-17-6-8(16)11(7)12(22)20-21-13(23)19-14-18-9-3-1-2-4-10(9)24-14/h1-6H,(H,20,22)(H2,18,19,21,23) |
| InChIKey | XATXSAVXPFREJI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|