C14H8F3N3OS — CID 43953194
2,6-difluoro-N'-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 43953194) has the molecular formula C14H8F3N3OS and a molecular weight of 323.30 g/mol. Its IUPAC name is 2,6-difluoro-N'-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 2,6-difluoro-N'-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 43953194 |
| Molecular Formula | C14H8F3N3OS |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2,6-difluoro-N'-(6-fluoro-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | O=C(NNc1nc2ccc(F)cc2s1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H8F3N3OS/c15-7-4-5-10-11(6-7)22-14(18-10)20-19-13(21)12-8(16)2-1-3-9(12)17/h1-6H,(H,18,20)(H,19,21) |
| InChIKey | BLEJJBOWVOLSHX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|