C14H8ClF2N3OS — CID 7105594
N'-(4-chloro-1,3-benzothiazol-2-yl)-2,6-difluorobenzohydrazide (PubChem CID 7105594) has the molecular formula C14H8ClF2N3OS and a molecular weight of 339.75 g/mol. Its IUPAC name is N'-(4-chloro-1,3-benzothiazol-2-yl)-2,6-difluorobenzohydrazide.
| Compound Name | N'-(4-chloro-1,3-benzothiazol-2-yl)-2,6-difluorobenzohydrazide |
|---|---|
| PubChem CID | 7105594 |
| Molecular Formula | C14H8ClF2N3OS |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | N'-(4-chloro-1,3-benzothiazol-2-yl)-2,6-difluorobenzohydrazide |
| SMILES | O=C(NNc1nc2c(Cl)cccc2s1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H8ClF2N3OS/c15-7-3-1-6-10-12(7)18-14(22-10)20-19-13(21)11-8(16)4-2-5-9(11)17/h1-6H,(H,18,20)(H,19,21) |
| InChIKey | FTVXUUTWBDPXEE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|