C17H10FN3O3S — CID 7105566
N'-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carbohydrazide (PubChem CID 7105566) has the molecular formula C17H10FN3O3S and a molecular weight of 355.35 g/mol. Its IUPAC name is N'-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carbohydrazide.
| Compound Name | N'-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carbohydrazide |
|---|---|
| PubChem CID | 7105566 |
| Molecular Formula | C17H10FN3O3S |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N'-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carbohydrazide |
| SMILES | O=C(NNc1nc2c(F)cccc2s1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C17H10FN3O3S/c18-10-5-3-7-14-15(10)19-17(25-14)21-20-16(23)13-8-11(22)9-4-1-2-6-12(9)24-13/h1-8H,(H,19,21)(H,20,23) |
| InChIKey | CYHQLWNMDRQAIK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|