C26H16N2O4S — CID 4072632
N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-oxochromene-2-carboxamide (PubChem CID 4072632) has the molecular formula C26H16N2O4S and a molecular weight of 452.49 g/mol. Its IUPAC name is N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-oxochromene-2-carboxamide.
| Compound Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 4072632 |
| Molecular Formula | C26H16N2O4S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)-4-oxochromene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C26H16N2O4S/c29-19-15-21(32-20-14-8-7-13-18(19)20)25(31)28-26-27-22(16-9-3-1-4-10-16)24(33-26)23(30)17-11-5-2-6-12-17/h1-15H,(H,27,28,31) |
| InChIKey | QDRTVCPQXLWYJL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |