C17H9FN2O3S — CID 7193218
N-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carboxamide (PubChem CID 7193218) has the molecular formula C17H9FN2O3S and a molecular weight of 340.33 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carboxamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 7193218 |
| Molecular Formula | C17H9FN2O3S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-4-oxochromene-2-carboxamide |
| SMILES | O=C(Nc1nc2c(F)cccc2s1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C17H9FN2O3S/c18-10-5-3-7-14-15(10)19-17(24-14)20-16(22)13-8-11(21)9-4-1-2-6-12(9)23-13/h1-8H,(H,19,20,22) |
| InChIKey | FZGCGIPKAFIOPZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |