C16H15N3O3S — CID 78778902
N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-oxochromene-2-carboxamide (PubChem CID 78778902) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-oxochromene-2-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 78778902 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-oxochromene-2-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2cc(=O)c3ccccc3o2)s1 |
| InChI | InChI=1S/C16H15N3O3S/c1-2-3-8-14-18-19-16(23-14)17-15(21)13-9-11(20)10-6-4-5-7-12(10)22-13/h4-7,9H,2-3,8H2,1H3,(H,17,19,21) |
| InChIKey | WLPSZWTWDIOEBF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |