C16H16N4O2S — CID 51261982
N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 51261982) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 51261982 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2cc(-c3ccccc3)on2)s1 |
| InChI | InChI=1S/C16H16N4O2S/c1-2-3-9-14-18-19-16(23-14)17-15(21)12-10-13(22-20-12)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3,(H,17,19,21) |
| InChIKey | HFSBBINBPKUZPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |