C15H11F2N3O2S — CID 7105549
2,6-difluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 7105549) has the molecular formula C15H11F2N3O2S and a molecular weight of 335.34 g/mol. Its IUPAC name is 2,6-difluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 2,6-difluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 7105549 |
| Molecular Formula | C15H11F2N3O2S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2,6-difluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | COc1cccc2sc(NNC(=O)c3c(F)cccc3F)nc12 |
| InChI | InChI=1S/C15H11F2N3O2S/c1-22-10-6-3-7-11-13(10)18-15(23-11)20-19-14(21)12-8(16)4-2-5-9(12)17/h2-7H,1H3,(H,18,20)(H,19,21) |
| InChIKey | YBZHULPXNHZQDB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|