C16H15N3O3S — CID 7105536
3-methoxy-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 7105536) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-methoxy-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 3-methoxy-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 7105536 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-methoxy-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | COc1cccc(C(=O)NNc2nc3c(OC)cccc3s2)c1 |
| InChI | InChI=1S/C16H15N3O3S/c1-21-11-6-3-5-10(9-11)15(20)18-19-16-17-14-12(22-2)7-4-8-13(14)23-16/h3-9H,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | KHJYVJPZGBVTSW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|