C15H12FN3O2S — CID 7105534
4-fluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide (PubChem CID 7105534) has the molecular formula C15H12FN3O2S and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-fluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide.
| Compound Name | 4-fluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 7105534 |
| Molecular Formula | C15H12FN3O2S |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-fluoro-N'-(4-methoxy-1,3-benzothiazol-2-yl)benzohydrazide |
| SMILES | COc1cccc2sc(NNC(=O)c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C15H12FN3O2S/c1-21-11-3-2-4-12-13(11)17-15(22-12)19-18-14(20)9-5-7-10(16)8-6-9/h2-8H,1H3,(H,17,19)(H,18,20) |
| InChIKey | YWZZFSFMGTZECK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|