C19H16N4O2S — CID 43953096
N'-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylquinoline-6-carbohydrazide (PubChem CID 43953096) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N'-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylquinoline-6-carbohydrazide.
| Compound Name | N'-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylquinoline-6-carbohydrazide |
|---|---|
| PubChem CID | 43953096 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N'-(4-methoxy-1,3-benzothiazol-2-yl)-2-methylquinoline-6-carbohydrazide |
| SMILES | COc1cccc2sc(NNC(=O)c3ccc4nc(C)ccc4c3)nc12 |
| InChI | InChI=1S/C19H16N4O2S/c1-11-6-7-12-10-13(8-9-14(12)20-11)18(24)22-23-19-21-17-15(25-2)4-3-5-16(17)26-19/h3-10H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | WUUJFBGLDDIKRK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|